C18H17F3N4O5 — CID 162676778
ethyl 5-[3-[2-amino-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propyl]-1,2-oxazole-3-carboxylate (PubChem CID 162676778) has the molecular formula C18H17F3N4O5 and a molecular weight of 426.35 g/mol. Its IUPAC name is ethyl 5-[3-[2-amino-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propyl]-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[3-[2-amino-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propyl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 162676778 |
| Molecular Formula | C18H17F3N4O5 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | ethyl 5-[3-[2-amino-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]propyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CCCOc2ccc(-c3noc(C(F)(F)F)n3)cc2N)on1 |
| InChI | InChI=1S/C18H17F3N4O5/c1-2-27-16(26)13-9-11(29-24-13)4-3-7-28-14-6-5-10(8-12(14)22)15-23-17(30-25-15)18(19,20)21/h5-6,8-9H,2-4,7,22H2,1H3 |
| InChIKey | QDTXGQHXQUVYBN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|