C18H18F3N3O4 — CID 19804376
3-[4-[3-[3-(methoxymethyl)-1,2-oxazol-5-yl]propoxy]-3-(trifluoromethyl)phenyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 19804376) has the molecular formula C18H18F3N3O4 and a molecular weight of 397.35 g/mol. Its IUPAC name is 3-[4-[3-[3-(methoxymethyl)-1,2-oxazol-5-yl]propoxy]-3-(trifluoromethyl)phenyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[4-[3-[3-(methoxymethyl)-1,2-oxazol-5-yl]propoxy]-3-(trifluoromethyl)phenyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19804376 |
| Molecular Formula | C18H18F3N3O4 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 3-[4-[3-[3-(methoxymethyl)-1,2-oxazol-5-yl]propoxy]-3-(trifluoromethyl)phenyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | COCc1cc(CCCOc2ccc(-c3noc(C)n3)cc2C(F)(F)F)on1 |
| InChI | InChI=1S/C18H18F3N3O4/c1-11-22-17(24-27-11)12-5-6-16(15(8-12)18(19,20)21)26-7-3-4-14-9-13(10-25-2)23-28-14/h5-6,8-9H,3-4,7,10H2,1-2H3 |
| InChIKey | JIRSYJNKVDNRQE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 83.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|