About 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole
2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole (PubChem CID 162677102) has the molecular formula C19H20BrN3S
and a molecular weight of 402.36 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole |
| PubChem CID | 162677102 |
| Molecular Formula | C19H20BrN3S |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole |
| SMILES | Brc1ccc(SCCCN2CCn3c(nc4ccccc43)C2)cc1 |
| InChI | InChI=1S/C19H20BrN3S/c20-15-6-8-16(9-7-15)24-13-3-10-22-11-12-23-18-5-2-1-4-17(18)21-19(23)14-22/h1-2,4-9H,3,10-14H2 |
| InChIKey | SEGLEOWKVFCAAN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole?
The IUPAC name of 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole (CID 162677102) is 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole.
What is the SMILES notation for 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole?
The canonical SMILES for 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole is Brc1ccc(SCCCN2CCn3c(nc4ccccc43)C2)cc1.
What is the InChIKey of 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole?
The InChIKey is SEGLEOWKVFCAAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20BrN3S/c20-15-6-8-16(9-7-15)24-13-3-10-22-11-12-23-18-5-2-1-4-17(18)21-19(23)14-22/h1-2,4-9H,3,10-14H2.
What are the key properties of 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole?
2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole has a molecular weight of 402.36 g/mol, XLogP of 4.80, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-bromophenyl)sulfanylpropyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole is sourced from PubChem (CID 162677102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).