C15H22N4O3S — CID 50750481
N-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]methanesulfonamide (PubChem CID 50750481) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]methanesulfonamide.
| Compound Name | N-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 50750481 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]methanesulfonamide |
| SMILES | COCCCN1CCn2c(nc3cc(NS(C)(=O)=O)ccc32)C1 |
| InChI | InChI=1S/C15H22N4O3S/c1-22-9-3-6-18-7-8-19-14-5-4-12(17-23(2,20)21)10-13(14)16-15(19)11-18/h4-5,10,17H,3,6-9,11H2,1-2H3 |
| InChIKey | TWOBVLQZSFQPHT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|