C23H22N4O3S — CID 2038541
N-[2-(4-methoxyphenyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]benzenesulfonamide (PubChem CID 2038541) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]benzenesulfonamide.
| Compound Name | N-[2-(4-methoxyphenyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2038541 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]benzenesulfonamide |
| SMILES | COc1ccc(N2CCn3c(nc4cc(NS(=O)(=O)c5ccccc5)ccc43)C2)cc1 |
| InChI | InChI=1S/C23H22N4O3S/c1-30-19-10-8-18(9-11-19)26-13-14-27-22-12-7-17(15-21(22)24-23(27)16-26)25-31(28,29)20-5-3-2-4-6-20/h2-12,15,25H,13-14,16H2,1H3 |
| InChIKey | FNZPAVYXANPXQZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|