C26H35N5O8S — CID 162678122
[(2S)-2-hydroxy-2-[1-[3-(5-methyl-4-oxo-7-propyl-4aH-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperidin-4-yl]ethyl] nitrate (PubChem CID 162678122) has the molecular formula C26H35N5O8S and a molecular weight of 577.66 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[1-[3-(5-methyl-4-oxo-7-propyl-4aH-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperidin-4-yl]ethyl] nitrate.
| Compound Name | [(2S)-2-hydroxy-2-[1-[3-(5-methyl-4-oxo-7-propyl-4aH-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperidin-4-yl]ethyl] nitrate |
|---|---|
| PubChem CID | 162678122 |
| Molecular Formula | C26H35N5O8S |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | [(2S)-2-hydroxy-2-[1-[3-(5-methyl-4-oxo-7-propyl-4aH-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperidin-4-yl]ethyl] nitrate |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCC([C@H](O)CO[N+](=O)[O-])CC2)cc1C1=NC(=O)C2C(=N1)C(CCC)=CN2C |
| InChI | InChI=1S/C26H35N5O8S/c1-4-6-18-15-29(3)24-23(18)27-25(28-26(24)33)20-14-19(7-8-22(20)38-13-5-2)40(36,37)30-11-9-17(10-12-30)21(32)16-39-31(34)35/h7-8,14-15,17,21,24,32H,4-6,9-13,16H2,1-3H3/t21-,24?/m1/s1 |
| InChIKey | NCQGZTVGUKJLGJ-CILPGNKCSA-N |
| XLogP | 2.17 |
| TPSA | 164.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|