C24H37BrClN3O3Si — CID 162680417
ethyl 7-bromo-4-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-2-yl]amino]-2-chloro-1,5-naphthyridine-3-carboxylate (PubChem CID 162680417) has the molecular formula C24H37BrClN3O3Si and a molecular weight of 559.02 g/mol. Its IUPAC name is ethyl 7-bromo-4-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-2-yl]amino]-2-chloro-1,5-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-bromo-4-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-2-yl]amino]-2-chloro-1,5-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 162680417 |
| Molecular Formula | C24H37BrClN3O3Si |
| Molecular Weight | 559.02 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | ethyl 7-bromo-4-[[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-2-yl]amino]-2-chloro-1,5-naphthyridine-3-carboxylate |
| SMILES | CCCC[C@](C)(CO[Si](C)(C)C(C)(C)C)Nc1c(C(=O)OCC)c(Cl)nc2cc(Br)cnc12 |
| InChI | InChI=1S/C24H37BrClN3O3Si/c1-9-11-12-24(6,15-32-33(7,8)23(3,4)5)29-20-18(22(30)31-10-2)21(26)28-17-13-16(25)14-27-19(17)20/h13-14H,9-12,15H2,1-8H3,(H,28,29)/t24-/m1/s1 |
| InChIKey | YHPYYXLCRNIUTO-XMMPIXPASA-N |
| XLogP | 7.61 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.02 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|