C16H20ClN3O3 — CID 175573187
ethyl 2-chloro-4-(1-hydroxypentan-2-ylamino)-1,5-naphthyridine-3-carboxylate (PubChem CID 175573187) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is ethyl 2-chloro-4-(1-hydroxypentan-2-ylamino)-1,5-naphthyridine-3-carboxylate.
| Compound Name | ethyl 2-chloro-4-(1-hydroxypentan-2-ylamino)-1,5-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 175573187 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | ethyl 2-chloro-4-(1-hydroxypentan-2-ylamino)-1,5-naphthyridine-3-carboxylate |
| SMILES | CCCC(CO)Nc1c(C(=O)OCC)c(Cl)nc2cccnc12 |
| InChI | InChI=1S/C16H20ClN3O3/c1-3-6-10(9-21)19-14-12(16(22)23-4-2)15(17)20-11-7-5-8-18-13(11)14/h5,7-8,10,21H,3-4,6,9H2,1-2H3,(H,19,20) |
| InChIKey | DTKFYZDFNGOCDX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|