C22H34ClN3O3Si — CID 175339496
4-[[1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-2-yl]amino]-2-chloro-1,5-naphthyridine-3-carboxylic acid (PubChem CID 175339496) has the molecular formula C22H34ClN3O3Si and a molecular weight of 452.07 g/mol. Its IUPAC name is 4-[[1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-2-yl]amino]-2-chloro-1,5-naphthyridine-3-carboxylic acid.
| Compound Name | 4-[[1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-2-yl]amino]-2-chloro-1,5-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 175339496 |
| Molecular Formula | C22H34ClN3O3Si |
| Molecular Weight | 452.07 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 4-[[1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-2-yl]amino]-2-chloro-1,5-naphthyridine-3-carboxylic acid |
| SMILES | CCCCC(C)(CO[Si](C)(C)C(C)(C)C)Nc1c(C(=O)O)c(Cl)nc2cccnc12 |
| InChI | InChI=1S/C22H34ClN3O3Si/c1-8-9-12-22(5,14-29-30(6,7)21(2,3)4)26-18-16(20(27)28)19(23)25-15-11-10-13-24-17(15)18/h10-11,13H,8-9,12,14H2,1-7H3,(H,25,26)(H,27,28) |
| InChIKey | LPGIYHKCVAJAKO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.07 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|