C25H25N5O7 — CID 162681824
2-(2,6-dioxopiperidin-3-yl)-5-[1-[2-(6-nitro-3-pyridinyl)ethyl]piperidin-4-yl]oxyisoindole-1,3-dione (PubChem CID 162681824) has the molecular formula C25H25N5O7 and a molecular weight of 507.50 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[1-[2-(6-nitro-3-pyridinyl)ethyl]piperidin-4-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[1-[2-(6-nitro-3-pyridinyl)ethyl]piperidin-4-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 162681824 |
| Molecular Formula | C25H25N5O7 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[1-[2-(6-nitro-3-pyridinyl)ethyl]piperidin-4-yl]oxyisoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OC4CCN(CCc5ccc([N+](=O)[O-])nc5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H25N5O7/c31-22-6-4-20(23(32)27-22)29-24(33)18-3-2-17(13-19(18)25(29)34)37-16-8-11-28(12-9-16)10-7-15-1-5-21(26-14-15)30(35)36/h1-3,5,13-14,16,20H,4,6-12H2,(H,27,31,32) |
| InChIKey | NGFDXRRCYLAIJV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 152.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|