About 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane
2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane (PubChem CID 162681954) has the molecular formula C14H29N3
and a molecular weight of 239.41 g/mol. Its IUPAC name is 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane.
Molecular Properties
| Compound Name | 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane |
| PubChem CID | 162681954 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane |
| SMILES | C=C(C)N/C(=N\C(C)(C)C)C(N)=C(C)C.CC |
| InChI | InChI=1S/C12H23N3.C2H6/c1-8(2)10(13)11(14-9(3)4)15-12(5,6)7;1-2/h3,13H2,1-2,4-7H3,(H,14,15);1-2H3 |
| InChIKey | FBLIGFWETJRQOO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane?
The IUPAC name of 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane (CID 162681954) is 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane.
What is the SMILES notation for 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane?
The canonical SMILES for 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane is C=C(C)N/C(=N\C(C)(C)C)C(N)=C(C)C.CC.
What is the InChIKey of 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane?
The InChIKey is FBLIGFWETJRQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3.C2H6/c1-8(2)10(13)11(14-9(3)4)15-12(5,6)7;1-2/h3,13H2,1-2,4-7H3,(H,14,15);1-2H3.
What are the key properties of 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane?
2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane has a molecular weight of 239.41 g/mol, XLogP of 3.59, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N'-tert-butyl-3-methyl-N-prop-1-en-2-ylbut-2-enimidamide;ethane is sourced from PubChem (CID 162681954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).