C10H16N2S — CID 89134882
(1E,3Z)-3-(1-aminoethenyl)-2-(prop-1-en-2-ylamino)penta-1,3-diene-1-thiol (PubChem CID 89134882) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is (1E,3Z)-3-(1-aminoethenyl)-2-(prop-1-en-2-ylamino)penta-1,3-diene-1-thiol.
| Compound Name | (1E,3Z)-3-(1-aminoethenyl)-2-(prop-1-en-2-ylamino)penta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 89134882 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (1E,3Z)-3-(1-aminoethenyl)-2-(prop-1-en-2-ylamino)penta-1,3-diene-1-thiol |
| SMILES | C=C(C)NC(=C/S)/C(=C\C)C(=C)N |
| InChI | InChI=1S/C10H16N2S/c1-5-9(8(4)11)10(6-13)12-7(2)3/h5-6,12-13H,2,4,11H2,1,3H3/b9-5-,10-6+ |
| InChIKey | QNSCDLNUOHLMEW-VTBWALSUSA-N |
| XLogP | 2.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|