C24H30S — CID 166778220
(1E,4Z,6Z)-4,6-di(ethylidene)-2,11-dimethyl-3,5,7,8,9,10-hexamethylidenedodeca-1,11-diene-1-thiol (PubChem CID 166778220) has the molecular formula C24H30S and a molecular weight of 350.57 g/mol. Its IUPAC name is (1E,4Z,6Z)-4,6-di(ethylidene)-2,11-dimethyl-3,5,7,8,9,10-hexamethylidenedodeca-1,11-diene-1-thiol.
| Compound Name | (1E,4Z,6Z)-4,6-di(ethylidene)-2,11-dimethyl-3,5,7,8,9,10-hexamethylidenedodeca-1,11-diene-1-thiol |
|---|---|
| PubChem CID | 166778220 |
| Molecular Formula | C24H30S |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1E,4Z,6Z)-4,6-di(ethylidene)-2,11-dimethyl-3,5,7,8,9,10-hexamethylidenedodeca-1,11-diene-1-thiol |
| SMILES | C=C(C)C(=C)C(=C)C(=C)C(=C)C(=CC)C(=C)/C(=C/C)C(=C)/C(C)=C/S |
| InChI | InChI=1S/C24H30S/c1-12-23(18(7)16(5)14-25)22(11)24(13-2)21(10)20(9)19(8)17(6)15(3)4/h12-14,25H,3,6-11H2,1-2,4-5H3/b16-14+,23-12+,24-13- |
| InChIKey | OOTWBSLQORQFFM-WCRRJTHSSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|