C16H26N2O3 — CID 162688013
(4S)-3,4-dimethyl-3-nitrosohexan-2-one;formamide;toluene (PubChem CID 162688013) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is (4S)-3,4-dimethyl-3-nitrosohexan-2-one;formamide;toluene.
| Compound Name | (4S)-3,4-dimethyl-3-nitrosohexan-2-one;formamide;toluene |
|---|---|
| PubChem CID | 162688013 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (4S)-3,4-dimethyl-3-nitrosohexan-2-one;formamide;toluene |
| SMILES | CC[C@H](C)C(C)(N=O)C(C)=O.Cc1ccccc1.NC=O |
| InChI | InChI=1S/C8H15NO2.C7H8.CH3NO/c1-5-6(2)8(4,9-11)7(3)10;1-7-5-3-2-4-6-7;2-1-3/h6H,5H2,1-4H3;2-6H,1H3;1H,(H2,2,3)/t6-,8?;;/m0../s1 |
| InChIKey | XGBKCJRBWNEMMP-LSXYXRMLSA-N |
| XLogP | 3.24 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|