C7H9F3N2OS — CID 162690523
(2S,5R)-6-sulfanyl-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 162690523) has the molecular formula C7H9F3N2OS and a molecular weight of 226.22 g/mol. Its IUPAC name is (2S,5R)-6-sulfanyl-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2S,5R)-6-sulfanyl-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 162690523 |
| Molecular Formula | C7H9F3N2OS |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | (2S,5R)-6-sulfanyl-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N(S)[C@@H]2CC[C@@H](C(F)(F)F)N1C2 |
| InChI | InChI=1S/C7H9F3N2OS/c8-7(9,10)5-2-1-4-3-11(5)6(13)12(4)14/h4-5,14H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | QXRQPPHRJQBQER-UHNVWZDZSA-N |
| XLogP | 1.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|