C15H24O2 — CID 162691813
6-hydroxy-6-nonylcyclohexa-2,4-dien-1-one (PubChem CID 162691813) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 6-hydroxy-6-nonylcyclohexa-2,4-dien-1-one.
| Compound Name | 6-hydroxy-6-nonylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 162691813 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 6-hydroxy-6-nonylcyclohexa-2,4-dien-1-one |
| SMILES | CCCCCCCCCC1(O)C=CC=CC1=O |
| InChI | InChI=1S/C15H24O2/c1-2-3-4-5-6-7-9-12-15(17)13-10-8-11-14(15)16/h8,10-11,13,17H,2-7,9,12H2,1H3 |
| InChIKey | QQWWYNUOSIIROB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|