C38H49IrN2O2- — CID 162692359
4-(3-tert-butylbenzene-6-id-1-yl)-6-methyl-2-propan-2-ylbenzo[h]quinazoline;(Z)-5-hydroxy-2,2,4,6,6-pentamethylhept-4-en-3-one;iridium (PubChem CID 162692359) has the molecular formula C38H49IrN2O2- and a molecular weight of 758.04 g/mol. Its IUPAC name is 4-(3-tert-butylbenzene-6-id-1-yl)-6-methyl-2-propan-2-ylbenzo[h]quinazoline;(Z)-5-hydroxy-2,2,4,6,6-pentamethylhept-4-en-3-one;iridium.
| Compound Name | 4-(3-tert-butylbenzene-6-id-1-yl)-6-methyl-2-propan-2-ylbenzo[h]quinazoline;(Z)-5-hydroxy-2,2,4,6,6-pentamethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 162692359 |
| Molecular Formula | C38H49IrN2O2- |
| Molecular Weight | 758.04 g/mol |
| Exact Mass | 758.34 |
| IUPAC Name | 4-(3-tert-butylbenzene-6-id-1-yl)-6-methyl-2-propan-2-ylbenzo[h]quinazoline;(Z)-5-hydroxy-2,2,4,6,6-pentamethylhept-4-en-3-one;iridium |
| SMILES | C/C(C(=O)C(C)(C)C)=C(/O)C(C)(C)C.Cc1cc2c(-c3[c-]ccc(C(C)(C)C)c3)nc(C(C)C)nc2c2ccccc12.[Ir] |
| InChI | InChI=1S/C26H27N2.C12H22O2.Ir/c1-16(2)25-27-23(18-10-9-11-19(15-18)26(4,5)6)22-14-17(3)20-12-7-8-13-21(20)24(22)28-25;1-8(9(13)11(2,3)4)10(14)12(5,6)7;/h7-9,11-16H,1-6H3;13H,1-7H3;/q-1;;/b;9-8-; |
| InChIKey | RUSLTCZACOUFEF-UVEFWQJBSA-N |
| XLogP | 10.46 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.04 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|