C42H57IrN2O2- — CID 168852687
2,4-ditert-butyl-7-(3-tert-butylbenzene-6-id-1-yl)-3,8-phenanthroline;(Z)-5-hydroxy-2,2,4,6,6-pentamethylhept-4-en-3-one;iridium (PubChem CID 168852687) has the molecular formula C42H57IrN2O2- and a molecular weight of 814.15 g/mol. Its IUPAC name is 2,4-ditert-butyl-7-(3-tert-butylbenzene-6-id-1-yl)-3,8-phenanthroline;(Z)-5-hydroxy-2,2,4,6,6-pentamethylhept-4-en-3-one;iridium.
| Compound Name | 2,4-ditert-butyl-7-(3-tert-butylbenzene-6-id-1-yl)-3,8-phenanthroline;(Z)-5-hydroxy-2,2,4,6,6-pentamethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 168852687 |
| Molecular Formula | C42H57IrN2O2- |
| Molecular Weight | 814.15 g/mol |
| Exact Mass | 814.41 |
| IUPAC Name | 2,4-ditert-butyl-7-(3-tert-butylbenzene-6-id-1-yl)-3,8-phenanthroline;(Z)-5-hydroxy-2,2,4,6,6-pentamethylhept-4-en-3-one;iridium |
| SMILES | C/C(C(=O)C(C)(C)C)=C(/O)C(C)(C)C.CC(C)(C)c1cc[c-]c(-c2nccc3c2ccc2c(C(C)(C)C)nc(C(C)(C)C)cc23)c1.[Ir] |
| InChI | InChI=1S/C30H35N2.C12H22O2.Ir/c1-28(2,3)20-12-10-11-19(17-20)26-22-13-14-23-24(21(22)15-16-31-26)18-25(29(4,5)6)32-27(23)30(7,8)9;1-8(9(13)11(2,3)4)10(14)12(5,6)7;/h10,12-18H,1-9H3;13H,1-7H3;/q-1;;/b;9-8-; |
| InChIKey | FXVQXRCUNPKMAZ-UVEFWQJBSA-N |
| XLogP | 11.62 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.15 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|