C32H36N4O7 — CID 162697212
(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)-5-(3-phenyloxaziridin-2-yl)pentanoyl]amino]-5-(3-phenyloxaziridin-2-yl)pentanoic acid (PubChem CID 162697212) has the molecular formula C32H36N4O7 and a molecular weight of 588.66 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)-5-(3-phenyloxaziridin-2-yl)pentanoyl]amino]-5-(3-phenyloxaziridin-2-yl)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)-5-(3-phenyloxaziridin-2-yl)pentanoyl]amino]-5-(3-phenyloxaziridin-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 162697212 |
| Molecular Formula | C32H36N4O7 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | (2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)-5-(3-phenyloxaziridin-2-yl)pentanoyl]amino]-5-(3-phenyloxaziridin-2-yl)pentanoic acid |
| SMILES | O=C(N[C@@H](CCCN1OC1c1ccccc1)C(=O)N[C@@H](CCCN1OC1c1ccccc1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C32H36N4O7/c37-28(33-27(31(38)39)19-11-21-36-30(43-36)25-16-8-3-9-17-25)26(34-32(40)41-22-23-12-4-1-5-13-23)18-10-20-35-29(42-35)24-14-6-2-7-15-24/h1-9,12-17,26-27,29-30H,10-11,18-22H2,(H,33,37)(H,34,40)(H,38,39)/t26-,27-,29?,30?,35?,36?/m0/s1 |
| InChIKey | UORKHJTXPHJHLM-FGABRDDYSA-N |
| XLogP | 4.30 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|