C24H45NSi — CID 162697742
(8-tert-butyl-10-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)methyl-trimethylsilane (PubChem CID 162697742) has the molecular formula C24H45NSi and a molecular weight of 375.72 g/mol. Its IUPAC name is (8-tert-butyl-10-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)methyl-trimethylsilane.
| Compound Name | (8-tert-butyl-10-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)methyl-trimethylsilane |
|---|---|
| PubChem CID | 162697742 |
| Molecular Formula | C24H45NSi |
| Molecular Weight | 375.72 g/mol |
| Exact Mass | 375.33 |
| IUPAC Name | (8-tert-butyl-10-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)methyl-trimethylsilane |
| SMILES | CC1C2CCCCC2C2C1C1CC(C(C)(C)C)CCC1N2C[Si](C)(C)C |
| InChI | InChI=1S/C24H45NSi/c1-16-18-10-8-9-11-19(18)23-22(16)20-14-17(24(2,3)4)12-13-21(20)25(23)15-26(5,6)7/h16-23H,8-15H2,1-7H3 |
| InChIKey | IGWSCBGMWFWRPN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.72 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|