C33H31N5O3 — CID 162699491
N-ethyl-N-[3-[[6-[2-[(4-methoxyphenyl)methoxy]-4-methyl-3-pyridinyl]quinazolin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 162699491) has the molecular formula C33H31N5O3 and a molecular weight of 545.64 g/mol. Its IUPAC name is N-ethyl-N-[3-[[6-[2-[(4-methoxyphenyl)methoxy]-4-methyl-3-pyridinyl]quinazolin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-ethyl-N-[3-[[6-[2-[(4-methoxyphenyl)methoxy]-4-methyl-3-pyridinyl]quinazolin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162699491 |
| Molecular Formula | C33H31N5O3 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | N-ethyl-N-[3-[[6-[2-[(4-methoxyphenyl)methoxy]-4-methyl-3-pyridinyl]quinazolin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CC)c1cccc(Nc2ncc3cc(-c4c(C)ccnc4OCc4ccc(OC)cc4)ccc3n2)c1 |
| InChI | InChI=1S/C33H31N5O3/c1-5-30(39)38(6-2)27-9-7-8-26(19-27)36-33-35-20-25-18-24(12-15-29(25)37-33)31-22(3)16-17-34-32(31)41-21-23-10-13-28(40-4)14-11-23/h5,7-20H,1,6,21H2,2-4H3,(H,35,36,37) |
| InChIKey | XSWHYFPTSDLTAQ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|