C25H23N5O2 — CID 162699485
N-[3-[[6-(4-methyl-2-oxo-1H-pyridin-3-yl)quinazolin-2-yl]amino]phenyl]-N-(1,1,2,2,2-pentadeuterioethyl)prop-2-enamide (PubChem CID 162699485) has the molecular formula C25H23N5O2 and a molecular weight of 430.52 g/mol. Its IUPAC name is N-[3-[[6-(4-methyl-2-oxo-1H-pyridin-3-yl)quinazolin-2-yl]amino]phenyl]-N-(1,1,2,2,2-pentadeuterioethyl)prop-2-enamide.
| Compound Name | N-[3-[[6-(4-methyl-2-oxo-1H-pyridin-3-yl)quinazolin-2-yl]amino]phenyl]-N-(1,1,2,2,2-pentadeuterioethyl)prop-2-enamide |
|---|---|
| PubChem CID | 162699485 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | N-[3-[[6-(4-methyl-2-oxo-1H-pyridin-3-yl)quinazolin-2-yl]amino]phenyl]-N-(1,1,2,2,2-pentadeuterioethyl)prop-2-enamide |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C(=O)C=C)c1cccc(Nc2ncc3cc(-c4c(C)cc[nH]c4=O)ccc3n2)c1 |
| InChI | InChI=1S/C25H23N5O2/c1-4-22(31)30(5-2)20-8-6-7-19(14-20)28-25-27-15-18-13-17(9-10-21(18)29-25)23-16(3)11-12-26-24(23)32/h4,6-15H,1,5H2,2-3H3,(H,26,32)(H,27,28,29)/i2D3,5D2 |
| InChIKey | CNFLZPIWPBMQNA-ZTIZGVCASA-N |
| XLogP | 4.58 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|