C27H26N4O3 — CID 163557186
N-(2-methoxyethyl)-N-[3-[[6-(2-methyl-6-oxocyclohexa-1,3-dien-1-yl)quinazolin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 163557186) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[3-[[6-(2-methyl-6-oxocyclohexa-1,3-dien-1-yl)quinazolin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-(2-methoxyethyl)-N-[3-[[6-(2-methyl-6-oxocyclohexa-1,3-dien-1-yl)quinazolin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 163557186 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-(2-methoxyethyl)-N-[3-[[6-(2-methyl-6-oxocyclohexa-1,3-dien-1-yl)quinazolin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCOC)c1cccc(Nc2ncc3cc(C4=C(C)C=CCC4=O)ccc3n2)c1 |
| InChI | InChI=1S/C27H26N4O3/c1-4-25(33)31(13-14-34-3)22-9-6-8-21(16-22)29-27-28-17-20-15-19(11-12-23(20)30-27)26-18(2)7-5-10-24(26)32/h4-9,11-12,15-17H,1,10,13-14H2,2-3H3,(H,28,29,30) |
| InChIKey | RZGFSDIFRRURRU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|