About 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one
2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one (PubChem CID 163516568) has the molecular formula C23H22N4O
and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one |
| PubChem CID | 163516568 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one |
| SMILES | CCNc1cccc(Nc2ncc3cc(C4=C(C)C=CCC4=O)ccc3n2)c1 |
| InChI | InChI=1S/C23H22N4O/c1-3-24-18-7-5-8-19(13-18)26-23-25-14-17-12-16(10-11-20(17)27-23)22-15(2)6-4-9-21(22)28/h4-8,10-14,24H,3,9H2,1-2H3,(H,25,26,27) |
| InChIKey | XDTVVWLULURKEQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one?
The IUPAC name of 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one (CID 163516568) is 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one is CCNc1cccc(Nc2ncc3cc(C4=C(C)C=CCC4=O)ccc3n2)c1.
What is the InChIKey of 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one?
The InChIKey is XDTVVWLULURKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O/c1-3-24-18-7-5-8-19(13-18)26-23-25-14-17-12-16(10-11-20(17)27-23)22-15(2)6-4-9-21(22)28/h4-8,10-14,24H,3,9H2,1-2H3,(H,25,26,27).
What are the key properties of 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one?
2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one has a molecular weight of 370.46 g/mol, XLogP of 5.11, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[3-(ethylamino)anilino]quinazolin-6-yl]-3-methylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 163516568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).