C34H31N5O3 — CID 162699496
N-ethyl-N-[3-[[6-[2-[(4-methoxyphenyl)methoxy]-4-methyl-3-pyridinyl]quinazolin-2-yl]amino]phenyl]but-2-ynamide (PubChem CID 162699496) has the molecular formula C34H31N5O3 and a molecular weight of 557.65 g/mol. Its IUPAC name is N-ethyl-N-[3-[[6-[2-[(4-methoxyphenyl)methoxy]-4-methyl-3-pyridinyl]quinazolin-2-yl]amino]phenyl]but-2-ynamide.
| Compound Name | N-ethyl-N-[3-[[6-[2-[(4-methoxyphenyl)methoxy]-4-methyl-3-pyridinyl]quinazolin-2-yl]amino]phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 162699496 |
| Molecular Formula | C34H31N5O3 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | N-ethyl-N-[3-[[6-[2-[(4-methoxyphenyl)methoxy]-4-methyl-3-pyridinyl]quinazolin-2-yl]amino]phenyl]but-2-ynamide |
| SMILES | CC#CC(=O)N(CC)c1cccc(Nc2ncc3cc(-c4c(C)ccnc4OCc4ccc(OC)cc4)ccc3n2)c1 |
| InChI | InChI=1S/C34H31N5O3/c1-5-8-31(40)39(6-2)28-10-7-9-27(20-28)37-34-36-21-26-19-25(13-16-30(26)38-34)32-23(3)17-18-35-33(32)42-22-24-11-14-29(41-4)15-12-24/h7,9-21H,6,22H2,1-4H3,(H,36,37,38) |
| InChIKey | NDMUQIVMFOTXSF-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|