C24H30N5O7P — CID 162713269
propan-2-yl 2-[[[(1S,3S,5S)-3-(4-amino-2-oxopyrimidin-1-yl)-5-hydroxy-1-isocyano-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 162713269) has the molecular formula C24H30N5O7P and a molecular weight of 531.51 g/mol. Its IUPAC name is propan-2-yl 2-[[[(1S,3S,5S)-3-(4-amino-2-oxopyrimidin-1-yl)-5-hydroxy-1-isocyano-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(1S,3S,5S)-3-(4-amino-2-oxopyrimidin-1-yl)-5-hydroxy-1-isocyano-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 162713269 |
| Molecular Formula | C24H30N5O7P |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | propan-2-yl 2-[[[(1S,3S,5S)-3-(4-amino-2-oxopyrimidin-1-yl)-5-hydroxy-1-isocyano-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | [C-]#[N+][C@]1(COP(=O)(NC(C)C(=O)OC(C)C)Oc2ccccc2)C(=C)[C@@H](n2ccc(N)nc2=O)C[C@@H]1O |
| InChI | InChI=1S/C24H30N5O7P/c1-15(2)35-22(31)17(4)28-37(33,36-18-9-7-6-8-10-18)34-14-24(26-5)16(3)19(13-20(24)30)29-12-11-21(25)27-23(29)32/h6-12,15,17,19-20,30H,3,13-14H2,1-2,4H3,(H,28,33)(H2,25,27,32)/t17?,19-,20-,24+,37?/m0/s1 |
| InChIKey | QEMJTCIPDRTMFG-GKZPYQAWSA-N |
| XLogP | 2.48 |
| TPSA | 159.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|