C26H32N7O6P — CID 163909584
propan-2-yl 2-[[[(1S,3S,5S)-3-(2-amino-6-methylidene-1H-purin-9-yl)-5-hydroxy-1-isocyano-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 163909584) has the molecular formula C26H32N7O6P and a molecular weight of 569.56 g/mol. Its IUPAC name is propan-2-yl 2-[[[(1S,3S,5S)-3-(2-amino-6-methylidene-1H-purin-9-yl)-5-hydroxy-1-isocyano-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(1S,3S,5S)-3-(2-amino-6-methylidene-1H-purin-9-yl)-5-hydroxy-1-isocyano-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163909584 |
| Molecular Formula | C26H32N7O6P |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | propan-2-yl 2-[[[(1S,3S,5S)-3-(2-amino-6-methylidene-1H-purin-9-yl)-5-hydroxy-1-isocyano-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | [C-]#[N+][C@]1(COP(=O)(NC(C)C(=O)OC(C)C)Oc2ccccc2)C(=C)[C@@H](n2cnc3c2N=C(N)NC3=C)C[C@@H]1O |
| InChI | InChI=1S/C26H32N7O6P/c1-15(2)38-24(35)18(5)32-40(36,39-19-10-8-7-9-11-19)37-13-26(28-6)16(3)20(12-21(26)34)33-14-29-22-17(4)30-25(27)31-23(22)33/h7-11,14-15,18,20-21,34H,3-4,12-13H2,1-2,5H3,(H,32,36)(H3,27,30,31)/t18?,20-,21-,26+,40?/m0/s1 |
| InChIKey | UHEKARLYUCCLGS-MKBIXRBVSA-N |
| XLogP | 3.06 |
| TPSA | 166.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|