C26H33N6O6P — CID 159794851
cyclobutyl (2S)-2-[[[(1R,3S,5S)-3-(2-amino-6-methylidene-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 159794851) has the molecular formula C26H33N6O6P and a molecular weight of 556.56 g/mol. Its IUPAC name is cyclobutyl (2S)-2-[[[(1R,3S,5S)-3-(2-amino-6-methylidene-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclobutyl (2S)-2-[[[(1R,3S,5S)-3-(2-amino-6-methylidene-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 159794851 |
| Molecular Formula | C26H33N6O6P |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | cyclobutyl (2S)-2-[[[(1R,3S,5S)-3-(2-amino-6-methylidene-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1NC(N)=Nc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC2CCC2)Oc2ccccc2)C1=C |
| InChI | InChI=1S/C26H33N6O6P/c1-15-20(22(33)12-21(15)32-14-28-23-16(2)29-26(27)30-24(23)32)13-36-39(35,38-19-8-5-4-6-9-19)31-17(3)25(34)37-18-10-7-11-18/h4-6,8-9,14,17-18,20-22,33H,1-2,7,10-13H2,3H3,(H,31,35)(H3,27,29,30)/t17-,20-,21-,22-,39-/m0/s1 |
| InChIKey | UAHHEEFFXVOOQB-AGFGXXTASA-N |
| XLogP | 3.16 |
| TPSA | 162.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|