C22H22N4O3S — CID 162717061
5-[(3aR,4R,6aS)-3-[4-(6,7-diazabicyclo[3.2.1]octa-1,3,5(8),6-tetraen-2-yl)phenyl]-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid (PubChem CID 162717061) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 5-[(3aR,4R,6aS)-3-[4-(6,7-diazabicyclo[3.2.1]octa-1,3,5(8),6-tetraen-2-yl)phenyl]-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid.
| Compound Name | 5-[(3aR,4R,6aS)-3-[4-(6,7-diazabicyclo[3.2.1]octa-1,3,5(8),6-tetraen-2-yl)phenyl]-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 162717061 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 5-[(3aR,4R,6aS)-3-[4-(6,7-diazabicyclo[3.2.1]octa-1,3,5(8),6-tetraen-2-yl)phenyl]-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid |
| SMILES | O=C(O)CCCC[C@H]1SC[C@H]2NC(=O)N(c3ccc(-c4ccc5cc4N=N5)cc3)[C@H]21 |
| InChI | InChI=1S/C22H22N4O3S/c27-20(28)4-2-1-3-19-21-18(12-30-19)23-22(29)26(21)15-8-5-13(6-9-15)16-10-7-14-11-17(16)25-24-14/h5-11,18-19,21H,1-4,12H2,(H,23,29)(H,27,28)/t18-,19-,21-/m1/s1 |
| InChIKey | AYDMRZUAISASHH-SFHLNBCPSA-N |
| XLogP | 5.11 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|