C16H18N2O5 — CID 162719815
butyl 6-hydroxy-4-oxo-5-phenyl-6,6a-dihydro-3aH-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate (PubChem CID 162719815) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is butyl 6-hydroxy-4-oxo-5-phenyl-6,6a-dihydro-3aH-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate.
| Compound Name | butyl 6-hydroxy-4-oxo-5-phenyl-6,6a-dihydro-3aH-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 162719815 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | butyl 6-hydroxy-4-oxo-5-phenyl-6,6a-dihydro-3aH-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate |
| SMILES | CCCCOC(=O)C1=NOC2C1C(=O)N(c1ccccc1)C2O |
| InChI | InChI=1S/C16H18N2O5/c1-2-3-9-22-16(21)12-11-13(23-17-12)15(20)18(14(11)19)10-7-5-4-6-8-10/h4-8,11,13,15,20H,2-3,9H2,1H3 |
| InChIKey | SJTZKOHRQGFDKQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|