C34H36N2P+ — CID 162723127
ethyl-[4-methyl-5-phenyl-2-(2-propylphenyl)pyridin-1-ium-1-yl]phosphane;2-phenylpyridine (PubChem CID 162723127) has the molecular formula C34H36N2P+ and a molecular weight of 503.65 g/mol. Its IUPAC name is ethyl-[4-methyl-5-phenyl-2-(2-propylphenyl)pyridin-1-ium-1-yl]phosphane;2-phenylpyridine.
| Compound Name | ethyl-[4-methyl-5-phenyl-2-(2-propylphenyl)pyridin-1-ium-1-yl]phosphane;2-phenylpyridine |
|---|---|
| PubChem CID | 162723127 |
| Molecular Formula | C34H36N2P+ |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | ethyl-[4-methyl-5-phenyl-2-(2-propylphenyl)pyridin-1-ium-1-yl]phosphane;2-phenylpyridine |
| SMILES | CCCc1ccccc1-c1cc(C)c(-c2ccccc2)c[n+]1PCC.c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C23H27NP.C11H9N/c1-4-11-19-14-9-10-15-21(19)23-16-18(3)22(17-24(23)25-5-2)20-12-7-6-8-13-20;1-2-6-10(7-3-1)11-8-4-5-9-12-11/h6-10,12-17,25H,4-5,11H2,1-3H3;1-9H/q+1; |
| InChIKey | JUOUJQQQOYJYRQ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|