C16H31N2O+ — CID 162728259
2-[[(4E)-1,6-dimethylcyclooct-4-ene-1-carbonyl]amino]ethyl-trimethylazanium (PubChem CID 162728259) has the molecular formula C16H31N2O+ and a molecular weight of 267.44 g/mol. Its IUPAC name is 2-[[(4E)-1,6-dimethylcyclooct-4-ene-1-carbonyl]amino]ethyl-trimethylazanium.
| Compound Name | 2-[[(4E)-1,6-dimethylcyclooct-4-ene-1-carbonyl]amino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 162728259 |
| Molecular Formula | C16H31N2O+ |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.24 |
| IUPAC Name | 2-[[(4E)-1,6-dimethylcyclooct-4-ene-1-carbonyl]amino]ethyl-trimethylazanium |
| SMILES | CC1/C=C\CCC(C)(C(=O)NCC[N+](C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N2O/c1-14-8-6-7-10-16(2,11-9-14)15(19)17-12-13-18(3,4)5/h6,8,14H,7,9-13H2,1-5H3/p+1/b8-6- |
| InChIKey | CFCRKPIYUMNMSE-VURMDHGXSA-O |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|