C26H27N5O2 — CID 162728437
(1E,3Z)-2-[1-(6,7-dimethoxy-4-phenylquinazolin-2-yl)pyrazol-4-yl]-N,N-dimethylpenta-1,3-dien-1-amine (PubChem CID 162728437) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is (1E,3Z)-2-[1-(6,7-dimethoxy-4-phenylquinazolin-2-yl)pyrazol-4-yl]-N,N-dimethylpenta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-2-[1-(6,7-dimethoxy-4-phenylquinazolin-2-yl)pyrazol-4-yl]-N,N-dimethylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 162728437 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (1E,3Z)-2-[1-(6,7-dimethoxy-4-phenylquinazolin-2-yl)pyrazol-4-yl]-N,N-dimethylpenta-1,3-dien-1-amine |
| SMILES | C/C=C\C(=C/N(C)C)c1cnn(-c2nc(-c3ccccc3)c3cc(OC)c(OC)cc3n2)c1 |
| InChI | InChI=1S/C26H27N5O2/c1-6-10-19(16-30(2)3)20-15-27-31(17-20)26-28-22-14-24(33-5)23(32-4)13-21(22)25(29-26)18-11-8-7-9-12-18/h6-17H,1-5H3/b10-6-,19-16+ |
| InChIKey | DKXVPLQYFROCJK-KQYNBXRASA-N |
| XLogP | 4.98 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|