C26H23N6O3S+ — CID 174198576
[4-[1-[4-[6-(dimethylamino)-3-pyridinyl]-6,7-dimethoxyquinazolin-2-yl]pyrazol-4-yl]phenyl]-oxosulfanium (PubChem CID 174198576) has the molecular formula C26H23N6O3S+ and a molecular weight of 499.58 g/mol. Its IUPAC name is [4-[1-[4-[6-(dimethylamino)-3-pyridinyl]-6,7-dimethoxyquinazolin-2-yl]pyrazol-4-yl]phenyl]-oxosulfanium.
| Compound Name | [4-[1-[4-[6-(dimethylamino)-3-pyridinyl]-6,7-dimethoxyquinazolin-2-yl]pyrazol-4-yl]phenyl]-oxosulfanium |
|---|---|
| PubChem CID | 174198576 |
| Molecular Formula | C26H23N6O3S+ |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | [4-[1-[4-[6-(dimethylamino)-3-pyridinyl]-6,7-dimethoxyquinazolin-2-yl]pyrazol-4-yl]phenyl]-oxosulfanium |
| SMILES | COc1cc2nc(-n3cc(-c4ccc([S+]=O)cc4)cn3)nc(-c3ccc(N(C)C)nc3)c2cc1OC |
| InChI | InChI=1S/C26H23N6O3S/c1-31(2)24-10-7-17(13-27-24)25-20-11-22(34-3)23(35-4)12-21(20)29-26(30-25)32-15-18(14-28-32)16-5-8-19(36-33)9-6-16/h5-15H,1-4H3/q+1 |
| InChIKey | VMYYRIUTJAFCHG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 95.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|