C10H10FRb2+ — CID 162732311
5-fluoro-1,2,3,4-tetrahydronaphthalen-3-ide;bis(rubidium(1+)) (PubChem CID 162732311) has the molecular formula C10H10FRb2+ and a molecular weight of 320.12 g/mol. Its IUPAC name is 5-fluoro-1,2,3,4-tetrahydronaphthalen-3-ide;bis(rubidium(1+)).
| Compound Name | 5-fluoro-1,2,3,4-tetrahydronaphthalen-3-ide;bis(rubidium(1+)) |
|---|---|
| PubChem CID | 162732311 |
| Molecular Formula | C10H10FRb2+ |
| Molecular Weight | 320.12 g/mol |
| Exact Mass | 318.90 |
| IUPAC Name | 5-fluoro-1,2,3,4-tetrahydronaphthalen-3-ide;bis(rubidium(1+)) |
| SMILES | Fc1cccc2c1C[CH-]CC2.[Rb+].[Rb+] |
| InChI | InChI=1S/C10H10F.2Rb/c11-10-7-3-5-8-4-1-2-6-9(8)10;;/h2-3,5,7H,1,4,6H2;;/q-1;2*+1 |
| InChIKey | JLMTYHVZLUPVCS-UHFFFAOYSA-N |
| XLogP | -3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.12 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|