C10H7F — CID 143897224
5-fluoro-2,3-didehydro-1,4-dihydronaphthalene (PubChem CID 143897224) has the molecular formula C10H7F and a molecular weight of 146.16 g/mol. Its IUPAC name is 5-fluoro-2,3-didehydro-1,4-dihydronaphthalene.
| Compound Name | 5-fluoro-2,3-didehydro-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 143897224 |
| Molecular Formula | C10H7F |
| Molecular Weight | 146.16 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 5-fluoro-2,3-didehydro-1,4-dihydronaphthalene |
| SMILES | Fc1cccc2c1CC#CC2 |
| InChI | InChI=1S/C10H7F/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7H,4,6H2 |
| InChIKey | FWWMXELHAMPPDM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|