C13H23N5 — CID 162735269
(2Z,4E)-3-amino-5-(dimethylamino)-2-ethenyl-N,N'-dimethyl-4-(methyliminomethyl)penta-2,4-dienimidamide (PubChem CID 162735269) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is (2Z,4E)-3-amino-5-(dimethylamino)-2-ethenyl-N,N'-dimethyl-4-(methyliminomethyl)penta-2,4-dienimidamide.
| Compound Name | (2Z,4E)-3-amino-5-(dimethylamino)-2-ethenyl-N,N'-dimethyl-4-(methyliminomethyl)penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 162735269 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | (2Z,4E)-3-amino-5-(dimethylamino)-2-ethenyl-N,N'-dimethyl-4-(methyliminomethyl)penta-2,4-dienimidamide |
| SMILES | C=CC(/C(=N/C)NC)=C(N)\C(/C=N/C)=C/N(C)C |
| InChI | InChI=1S/C13H23N5/c1-7-11(13(16-3)17-4)12(14)10(8-15-2)9-18(5)6/h7-9H,1,14H2,2-6H3,(H,16,17)/b10-9-,12-11-,15-8+ |
| InChIKey | ZCNZUXOQXUFDOY-YJPKBZGZSA-N |
| XLogP | 0.78 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|