C30H47BN2 — CID 162737067
CID 162737067 (PubChem CID 162737067) has the molecular formula C30H47BN2 and a molecular weight of 446.53 g/mol.
| Compound Name | CID 162737067 |
|---|---|
| PubChem CID | 162737067 |
| Molecular Formula | C30H47BN2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.38 |
| IUPAC Name | — |
| SMILES | [B]C1(C(=C)Cn2ccnc2C)CCC2C3CCC4CC(CC(C)C)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C30H47BN2/c1-20(2)17-23-9-12-28(5)24(18-23)7-8-25-26(28)10-13-29(6)27(25)11-14-30(29,31)21(3)19-33-16-15-32-22(33)4/h15-16,20,23-27H,3,7-14,17-19H2,1-2,4-6H3 |
| InChIKey | QSPCZJWKBSXHFB-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|