C23H29FN2O — CID 162740234
3-[(3-fluoro-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]-7-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]hydrazinylidene]heptan-2-one (PubChem CID 162740234) has the molecular formula C23H29FN2O and a molecular weight of 368.50 g/mol. Its IUPAC name is 3-[(3-fluoro-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]-7-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]hydrazinylidene]heptan-2-one.
| Compound Name | 3-[(3-fluoro-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]-7-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]hydrazinylidene]heptan-2-one |
|---|---|
| PubChem CID | 162740234 |
| Molecular Formula | C23H29FN2O |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 3-[(3-fluoro-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]-7-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]hydrazinylidene]heptan-2-one |
| SMILES | C=C/C=C(C=NN=CCCCC(CC1=CC(F)C(=C)C=C1)C(C)=O)\C=C/C |
| InChI | InChI=1S/C23H29FN2O/c1-5-9-20(10-6-2)17-26-25-14-8-7-11-22(19(4)27)15-21-13-12-18(3)23(24)16-21/h5-6,9-10,12-14,16-17,22-23H,1,3,7-8,11,15H2,2,4H3/b10-6-,20-9+,25-14?,26-17? |
| InChIKey | GTLCZTODJNSOFV-FVUWIEEYSA-N |
| XLogP | 5.89 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|