C15H21IN2O2 — CID 162741999
tert-butyl 3-(4-iodophenyl)-1,3-diazinane-1-carboxylate (PubChem CID 162741999) has the molecular formula C15H21IN2O2 and a molecular weight of 388.25 g/mol. Its IUPAC name is tert-butyl 3-(4-iodophenyl)-1,3-diazinane-1-carboxylate.
| Compound Name | tert-butyl 3-(4-iodophenyl)-1,3-diazinane-1-carboxylate |
|---|---|
| PubChem CID | 162741999 |
| Molecular Formula | C15H21IN2O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | tert-butyl 3-(4-iodophenyl)-1,3-diazinane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(c2ccc(I)cc2)C1 |
| InChI | InChI=1S/C15H21IN2O2/c1-15(2,3)20-14(19)18-10-4-9-17(11-18)13-7-5-12(16)6-8-13/h5-8H,4,9-11H2,1-3H3 |
| InChIKey | ZYGDKPZTPZUEJO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|