C23H26N4S — CID 162743476
N-(1H-indol-6-ylsulfanyl)-2-(3-methylazetidin-1-yl)-2-(1-methylindol-3-yl)ethanamine (PubChem CID 162743476) has the molecular formula C23H26N4S and a molecular weight of 390.56 g/mol. Its IUPAC name is N-(1H-indol-6-ylsulfanyl)-2-(3-methylazetidin-1-yl)-2-(1-methylindol-3-yl)ethanamine.
| Compound Name | N-(1H-indol-6-ylsulfanyl)-2-(3-methylazetidin-1-yl)-2-(1-methylindol-3-yl)ethanamine |
|---|---|
| PubChem CID | 162743476 |
| Molecular Formula | C23H26N4S |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-(1H-indol-6-ylsulfanyl)-2-(3-methylazetidin-1-yl)-2-(1-methylindol-3-yl)ethanamine |
| SMILES | CC1CN(C(CNSc2ccc3cc[nH]c3c2)c2cn(C)c3ccccc23)C1 |
| InChI | InChI=1S/C23H26N4S/c1-16-13-27(14-16)23(20-15-26(2)22-6-4-3-5-19(20)22)12-25-28-18-8-7-17-9-10-24-21(17)11-18/h3-11,15-16,23-25H,12-14H2,1-2H3 |
| InChIKey | HEQMXIKGKLITRK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 35.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|