C24H25N5S2 — CID 162743449
N'-(1H-indol-6-ylsulfanyl)-N-methyl-1-(1-methylindol-3-yl)-N-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine (PubChem CID 162743449) has the molecular formula C24H25N5S2 and a molecular weight of 447.63 g/mol. Its IUPAC name is N'-(1H-indol-6-ylsulfanyl)-N-methyl-1-(1-methylindol-3-yl)-N-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(1H-indol-6-ylsulfanyl)-N-methyl-1-(1-methylindol-3-yl)-N-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 162743449 |
| Molecular Formula | C24H25N5S2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N'-(1H-indol-6-ylsulfanyl)-N-methyl-1-(1-methylindol-3-yl)-N-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine |
| SMILES | CN(Cc1cncs1)C(CNSc1ccc2cc[nH]c2c1)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C24H25N5S2/c1-28(14-19-12-25-16-30-19)24(21-15-29(2)23-6-4-3-5-20(21)23)13-27-31-18-8-7-17-9-10-26-22(17)11-18/h3-12,15-16,24,26-27H,13-14H2,1-2H3 |
| InChIKey | DPDWMTQJGZWZMH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 48.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|