C24H27N5S2 — CID 162743478
N-(1H-indol-6-ylsulfanyl)-N'-methyl-N'-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine;1-methylindole (PubChem CID 162743478) has the molecular formula C24H27N5S2 and a molecular weight of 449.65 g/mol. Its IUPAC name is N-(1H-indol-6-ylsulfanyl)-N'-methyl-N'-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine;1-methylindole.
| Compound Name | N-(1H-indol-6-ylsulfanyl)-N'-methyl-N'-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine;1-methylindole |
|---|---|
| PubChem CID | 162743478 |
| Molecular Formula | C24H27N5S2 |
| Molecular Weight | 449.65 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | N-(1H-indol-6-ylsulfanyl)-N'-methyl-N'-(1,3-thiazol-5-ylmethyl)ethane-1,2-diamine;1-methylindole |
| SMILES | CN(CCNSc1ccc2cc[nH]c2c1)Cc1cncs1.Cn1ccc2ccccc21 |
| InChI | InChI=1S/C15H18N4S2.C9H9N/c1-19(10-14-9-16-11-20-14)7-6-18-21-13-3-2-12-4-5-17-15(12)8-13;1-10-7-6-8-4-2-3-5-9(8)10/h2-5,8-9,11,17-18H,6-7,10H2,1H3;2-7H,1H3 |
| InChIKey | BAZYPOVSIBERMF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 48.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|