C22H23N5OS — CID 162743829
1-(3-cyanopropyl)-N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]pyrrole-2-carboxamide (PubChem CID 162743829) has the molecular formula C22H23N5OS and a molecular weight of 405.53 g/mol. Its IUPAC name is 1-(3-cyanopropyl)-N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]pyrrole-2-carboxamide.
| Compound Name | 1-(3-cyanopropyl)-N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162743829 |
| Molecular Formula | C22H23N5OS |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-(3-cyanopropyl)-N-[4-(1-phenylpyrrolidin-2-yl)-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
| SMILES | N#CCCCn1cccc1C(=O)Nc1nc(C2CCCN2c2ccccc2)cs1 |
| InChI | InChI=1S/C22H23N5OS/c23-12-4-5-13-26-14-6-11-20(26)21(28)25-22-24-18(16-29-22)19-10-7-15-27(19)17-8-2-1-3-9-17/h1-3,6,8-9,11,14,16,19H,4-5,7,10,13,15H2,(H,24,25,28) |
| InChIKey | OUNRCFQQCBFSCF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|