C23H28N4O2S — CID 169049368
1-(4-methoxybutyl)-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide (PubChem CID 169049368) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-(4-methoxybutyl)-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide.
| Compound Name | 1-(4-methoxybutyl)-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 169049368 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-(4-methoxybutyl)-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
| SMILES | COCCCCn1cccc1C(=O)Nc1nc([C@H]2CCCN2c2ccccc2)cs1 |
| InChI | InChI=1S/C23H28N4O2S/c1-29-16-6-5-13-26-14-7-12-21(26)22(28)25-23-24-19(17-30-23)20-11-8-15-27(20)18-9-3-2-4-10-18/h2-4,7,9-10,12,14,17,20H,5-6,8,11,13,15-16H2,1H3,(H,24,25,28)/t20-/m1/s1 |
| InChIKey | PDUPFLYGGVQUIH-HXUWFJFHSA-N |
| XLogP | 4.97 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|