C25H31N5O2S — CID 162743980
1-[5-(dimethylamino)-5-oxopentyl]-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide (PubChem CID 162743980) has the molecular formula C25H31N5O2S and a molecular weight of 465.62 g/mol. Its IUPAC name is 1-[5-(dimethylamino)-5-oxopentyl]-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide.
| Compound Name | 1-[5-(dimethylamino)-5-oxopentyl]-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162743980 |
| Molecular Formula | C25H31N5O2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-[5-(dimethylamino)-5-oxopentyl]-N-[4-[(2R)-1-phenylpyrrolidin-2-yl]-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
| SMILES | CN(C)C(=O)CCCCn1cccc1C(=O)Nc1nc([C@H]2CCCN2c2ccccc2)cs1 |
| InChI | InChI=1S/C25H31N5O2S/c1-28(2)23(31)14-6-7-15-29-16-8-13-22(29)24(32)27-25-26-20(18-33-25)21-12-9-17-30(21)19-10-4-3-5-11-19/h3-5,8,10-11,13,16,18,21H,6-7,9,12,14-15,17H2,1-2H3,(H,26,27,32)/t21-/m1/s1 |
| InChIKey | SNIDGEWLILKQER-OAQYLSRUSA-N |
| XLogP | 4.80 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|