C17H23F4N4O8P — CID 162744451
diazanium;[(1S)-2,2,2-trifluoro-1-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxyoxolan-2-yl]ethyl] phosphate (PubChem CID 162744451) has the molecular formula C17H23F4N4O8P and a molecular weight of 518.36 g/mol. Its IUPAC name is diazanium;[(1S)-2,2,2-trifluoro-1-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxyoxolan-2-yl]ethyl] phosphate.
| Compound Name | diazanium;[(1S)-2,2,2-trifluoro-1-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxyoxolan-2-yl]ethyl] phosphate |
|---|---|
| PubChem CID | 162744451 |
| Molecular Formula | C17H23F4N4O8P |
| Molecular Weight | 518.36 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | diazanium;[(1S)-2,2,2-trifluoro-1-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxyoxolan-2-yl]ethyl] phosphate |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](OCc3ccccc3)[C@@H]([C@H](OP(=O)([O-])[O-])C(F)(F)F)O2)cc1F.[NH4+].[NH4+] |
| InChI | InChI=1S/C17H17F4N2O8P.2H3N/c18-10-7-23(16(25)22-15(10)24)12-6-11(29-8-9-4-2-1-3-5-9)13(30-12)14(17(19,20)21)31-32(26,27)28;;/h1-5,7,11-14H,6,8H2,(H,22,24,25)(H2,26,27,28);2*1H3/t11-,12+,13-,14-;;/m0../s1 |
| InChIKey | VMBQVHBRVXAJIM-YIZGWMCTSA-N |
| XLogP | 1.08 |
| TPSA | 218.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|