C27H36N2O3 — CID 162751846
tert-butyl 4-[(3-cyclopropyl-5-pyrrolidin-1-ylphenyl)methylamino]-3-ethoxybenzoate (PubChem CID 162751846) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is tert-butyl 4-[(3-cyclopropyl-5-pyrrolidin-1-ylphenyl)methylamino]-3-ethoxybenzoate.
| Compound Name | tert-butyl 4-[(3-cyclopropyl-5-pyrrolidin-1-ylphenyl)methylamino]-3-ethoxybenzoate |
|---|---|
| PubChem CID | 162751846 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | tert-butyl 4-[(3-cyclopropyl-5-pyrrolidin-1-ylphenyl)methylamino]-3-ethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OC(C)(C)C)ccc1NCc1cc(C2CC2)cc(N2CCCC2)c1 |
| InChI | InChI=1S/C27H36N2O3/c1-5-31-25-17-21(26(30)32-27(2,3)4)10-11-24(25)28-18-19-14-22(20-8-9-20)16-23(15-19)29-12-6-7-13-29/h10-11,14-17,20,28H,5-9,12-13,18H2,1-4H3 |
| InChIKey | DZPOPCONMDHJBB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |