C18H22BrNO4 — CID 162753628
5-bromo-1,3-dimethyl-7-[2-(oxan-2-yloxy)ethoxy]quinolin-2-one (PubChem CID 162753628) has the molecular formula C18H22BrNO4 and a molecular weight of 396.28 g/mol. Its IUPAC name is 5-bromo-1,3-dimethyl-7-[2-(oxan-2-yloxy)ethoxy]quinolin-2-one.
| Compound Name | 5-bromo-1,3-dimethyl-7-[2-(oxan-2-yloxy)ethoxy]quinolin-2-one |
|---|---|
| PubChem CID | 162753628 |
| Molecular Formula | C18H22BrNO4 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 5-bromo-1,3-dimethyl-7-[2-(oxan-2-yloxy)ethoxy]quinolin-2-one |
| SMILES | Cc1cc2c(Br)cc(OCCOC3CCCCO3)cc2n(C)c1=O |
| InChI | InChI=1S/C18H22BrNO4/c1-12-9-14-15(19)10-13(11-16(14)20(2)18(12)21)22-7-8-24-17-5-3-4-6-23-17/h9-11,17H,3-8H2,1-2H3 |
| InChIKey | PDRQCGIQVAMANI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|