C21H35N3O6 — CID 162756453
4-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,2-dimethylpropoxy]-N-(2-methoxyethyl)-3,3-dimethylbutanamide (PubChem CID 162756453) has the molecular formula C21H35N3O6 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,2-dimethylpropoxy]-N-(2-methoxyethyl)-3,3-dimethylbutanamide.
| Compound Name | 4-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,2-dimethylpropoxy]-N-(2-methoxyethyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 162756453 |
| Molecular Formula | C21H35N3O6 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 4-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,2-dimethylpropoxy]-N-(2-methoxyethyl)-3,3-dimethylbutanamide |
| SMILES | COCCNC(=O)CC(C)(C)COCC(C)(C)CNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H35N3O6/c1-20(2,12-17(26)22-9-11-29-5)14-30-15-21(3,4)13-23-16(25)8-10-24-18(27)6-7-19(24)28/h6-7H,8-15H2,1-5H3,(H,22,26)(H,23,25) |
| InChIKey | XKBPNZAFRKXLOB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|